Products 1934827-83-4
CAS 1934827-83-4 appears in our catalog under these names: tert-Butyl 3-fluoropicolinate, 95%, tert–Butyl 3–fluoropicolinate, 3-Fluoropyridine-2-carboxylic acid tert-butyl ester, tert-Butyl 3-fluoropicolinate 95%, Tert-Butyl 3-Fluoropicolinate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
Tert-butyl 3-fluoropyridine-2-carboxylate (CAS 1934827-83-4) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: tert-butyl 3-fluoropyridine-2-carboxylate. InChIKey: XOLAQCBNGMBLPQ-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | tert-butyl 3-fluoropyridine-2-carboxylate |
| InChIKey | XOLAQCBNGMBLPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC=N1)F |
Computed by PubChem (NCBI)