Products 1936375-20-0
CAS 1936375-20-0 is the registry number for 3,5-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3,5-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (CAS 1936375-20-0) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione. InChIKey: SLFLHQDFFIQXIJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 3,5-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| InChIKey | SLFLHQDFFIQXIJ-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C(=O)N(C(=O)N2)C |
Computed by PubChem (NCBI)