Products 193756-44-4
CAS 193756-44-4 appears in our catalog under these names: N-(2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide, Indacaterol Impurity 42. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
N-(2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide (CAS 193756-44-4) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: N-(2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide. InChIKey: BJOWSBJODJDOEY-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |
| InChIKey | BJOWSBJODJDOEY-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)