CAS 194-69-4 appears in our catalog under these names: Benzo(c)chrysene, 95%, 47173, Benzo[c]chrysene (purity). Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
Pentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene (CAS 194-69-4) is a chemical compound with the molecular formula C22H14 and a molecular weight of 278.3 g/mol. IUPAC name: pentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene. InChIKey: YZWGEMSQAMDWEM-UHFFFAOYSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | pentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene |
| InChIKey | YZWGEMSQAMDWEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)