Products 63912-16-3
CAS 63912-16-3 is the registry number for Pentacene-d14 (Major). Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg.
1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecadeuteriopentacene (CAS 63912-16-3) is a chemical compound with the molecular formula C22H14 and a molecular weight of 292.4 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecadeuteriopentacene. InChIKey: SLIUAWYAILUBJU-WZAAGXFHSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12,13,14-tetradecadeuteriopentacene |
| InChIKey | SLIUAWYAILUBJU-WZAAGXFHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C3C(=C4C(=C5C(=C(C(=C(C5=C(C4=C(C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)