CAS 47230-46-6 is the registry number for 4,4''-Diethynyl-1,1':4',1''-terphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-bis(4-ethynylphenyl)benzene (CAS 47230-46-6) is a chemical compound with the molecular formula C22H14 and a molecular weight of 278.3 g/mol. IUPAC name: 1,4-bis(4-ethynylphenyl)benzene. InChIKey: GJFFMABLPMLHJW-UHFFFAOYSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 1,4-bis(4-ethynylphenyl)benzene |
| InChIKey | GJFFMABLPMLHJW-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C#C |
Computed by PubChem (NCBI)