Products 196-78-1
CAS 196-78-1 appears in our catalog under these names: Benzo(g)chrysene, Benzo[g]chrysene, 98%, Benzo[g]chrysene, 98%, 98%. Offered by: Dr. Ehrenstorfer, Thermo Scientific (Acros), Chemat. Available pack sizes: 25mg, 1g, 100mg, 250mg.
Pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene (CAS 196-78-1) is a chemical compound with the molecular formula C22H14 and a molecular weight of 278.3 g/mol. IUPAC name: pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene. InChIKey: JZOIZKBKSZMVRV-UHFFFAOYSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
| InChIKey | JZOIZKBKSZMVRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)