Products 20199-29-5
CAS 20199-29-5 is the registry number for Bis(1-naphthyl)acetylene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
1-(2-naphthalen-1-ylethynyl)naphthalene (CAS 20199-29-5) is a chemical compound with the molecular formula C22H14 and a molecular weight of 278.3 g/mol. IUPAC name: 1-(2-naphthalen-1-ylethynyl)naphthalene. InChIKey: UJVHILYQAXYYRP-UHFFFAOYSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 1-(2-naphthalen-1-ylethynyl)naphthalene |
| InChIKey | UJVHILYQAXYYRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C#CC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)