CAS 19407-56-8 is the registry number for 5-Chloro-2-methylquinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-2-methyl-3H-quinazolin-4-one (CAS 19407-56-8) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 5-chloro-2-methyl-3H-quinazolin-4-one. InChIKey: GKDIFKSYPXLUJS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-chloro-2-methyl-3H-quinazolin-4-one |
| InChIKey | GKDIFKSYPXLUJS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC=C2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)