Products 19433-17-1
CAS 19433-17-1 is the registry number for (E)-Acetophenone O-acetyloxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
[(E)-1-phenylethylideneamino] acetate (CAS 19433-17-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: [(E)-1-phenylethylideneamino] acetate. InChIKey: TVBBAKXSFWTTLO-DHZHZOJOSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | [(E)-1-phenylethylideneamino] acetate |
| InChIKey | TVBBAKXSFWTTLO-DHZHZOJOSA-N |
| SMILES | C/C(=N\OC(=O)C)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)