Products 1946008-31-6
CAS 1946008-31-6 is the registry number for AChE/BuChE-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylquinoline (CAS 1946008-31-6) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylquinoline. InChIKey: BJQZRZYHRTZRQE-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylquinoline |
| InChIKey | BJQZRZYHRTZRQE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=NC3=CC=CC=C32)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)
Synonyms:
AChE/BuChE-IN-2, orb1689196