CAS 2733010-15-4 is the registry number for CIS-3-FLUOROCYCLOHEXAN-1-AMINE HCL, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
Cis-(1R,3S)-3-fluorocyclohexan-1-amine;hydrochloride (CAS 2733010-15-4) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: cis-(1R,3S)-3-fluorocyclohexan-1-amine;hydrochloride. InChIKey: QKCMJPLQBZUZRS-RIHPBJNCSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | cis-(1R,3S)-3-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | QKCMJPLQBZUZRS-RIHPBJNCSA-N |
| SMILES | C1C[C@H](C[C@H](C1)F)N.Cl |
Computed by PubChem (NCBI)