CAS 2227199-22-4 appears in our catalog under these names: Cis-3-fluorocyclohexan-1-amine hydrochloride, 95%, CIS-3-FLUOROCYCLOHEXAN-1-AMINE HCL, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 1g, 250mg, on request.
Cis-(1S,3R)-3-fluorocyclohexan-1-amine;hydrochloride (CAS 2227199-22-4) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: cis-(1S,3R)-3-fluorocyclohexan-1-amine;hydrochloride. InChIKey: QKCMJPLQBZUZRS-IBTYICNHSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | cis-(1S,3R)-3-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | QKCMJPLQBZUZRS-IBTYICNHSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)F)N.Cl |
Computed by PubChem (NCBI)