CAS 1951459-63-4 is the registry number for Benzyl ((3R,4R)-4-hydroxytetrahydro-2H-pyran-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(3R,4R)-4-hydroxyoxan-3-yl]carbamate (CAS 1951459-63-4) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: benzyl N-[(3R,4R)-4-hydroxyoxan-3-yl]carbamate. InChIKey: VLLNJWPYHKZWSR-VXGBXAGGSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | benzyl N-[(3R,4R)-4-hydroxyoxan-3-yl]carbamate |
| InChIKey | VLLNJWPYHKZWSR-VXGBXAGGSA-N |
| SMILES | C1COC[C@H]([C@@H]1O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)