CAS 19544-43-5 appears in our catalog under these names: 2-Benzylsuccinic Anhydride, 3-Benzyloxolane-2,5-dione. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
3-benzyloxolane-2,5-dione (CAS 19544-43-5) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 3-benzyloxolane-2,5-dione. InChIKey: OOEHLTSDDZKTQB-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-benzyloxolane-2,5-dione |
| InChIKey | OOEHLTSDDZKTQB-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)