Products 1955474-17-5
CAS 1955474-17-5 appears in our catalog under these names: (S)-1-Phenylpyrrolidin-3-amine hydrochloride, 95%, 95%, (3S)-1-PHENYLPYRROLIDIN-3-AMINE HYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-1-phenylpyrrolidin-3-amine;hydrochloride (CAS 1955474-17-5) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: (3S)-1-phenylpyrrolidin-3-amine;hydrochloride. InChIKey: BLERKSUNNKETEP-FVGYRXGTSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | (3S)-1-phenylpyrrolidin-3-amine;hydrochloride |
| InChIKey | BLERKSUNNKETEP-FVGYRXGTSA-N |
| SMILES | C1CN(C[C@H]1N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)