CAS 1955520-47-4 is the registry number for 2-Methyl-1,2,3,4-tetrahydroisoquinoline-5-sulfonyl chloride hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-3,4-dihydro-1H-isoquinoline-5-sulfonyl chloride;hydrochloride (CAS 1955520-47-4) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: 2-methyl-3,4-dihydro-1H-isoquinoline-5-sulfonyl chloride;hydrochloride. InChIKey: NJRTWIOTCHTXIZ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | 2-methyl-3,4-dihydro-1H-isoquinoline-5-sulfonyl chloride;hydrochloride |
| InChIKey | NJRTWIOTCHTXIZ-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C=CC=C2S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)