CAS 1955541-49-7 is the registry number for rel-(2R,3R)-2-(5-Bromopyridin-3-yl)tetrahydrofuran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylic acid (CAS 1955541-49-7) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylic acid. InChIKey: NHZNPAYDTGNYOJ-BDAKNGLRSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylic acid |
| InChIKey | NHZNPAYDTGNYOJ-BDAKNGLRSA-N |
| SMILES | C1CO[C@H]([C@@H]1C(=O)O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)