CAS 1955553-00-0 is the registry number for 8-(1,5-Dimethyl-1H-pyrazol-4-yl)-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-(1,5-dimethylpyrazol-4-yl)-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 1955553-00-0) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 8-(1,5-dimethylpyrazol-4-yl)-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: UIRROEUDARDBSX-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 8-(1,5-dimethylpyrazol-4-yl)-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | UIRROEUDARDBSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=CC3=C(C=C2)C(=O)CCCO3 |
Computed by PubChem (NCBI)