Products 1955554-54-7
CAS 1955554-54-7 is the registry number for {1-(3-(Trifluoromethoxy)phenyl)cyclobutyl}methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanamine;hydrochloride (CAS 1955554-54-7) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: [1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanamine;hydrochloride. InChIKey: RIYIBOAAGYEBOS-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | [1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanamine;hydrochloride |
| InChIKey | RIYIBOAAGYEBOS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=CC(=CC=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)