CAS 1955564-29-0 is the registry number for 3-Hydroxy-2-nitroso-n-phenylbut-2-enamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
(E)-3-hydroxy-2-nitroso-N-phenylbut-2-enamide (CAS 1955564-29-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: (E)-3-hydroxy-2-nitroso-N-phenylbut-2-enamide. InChIKey: HMVFHMLPFAZHEW-VQHVLOKHSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | (E)-3-hydroxy-2-nitroso-N-phenylbut-2-enamide |
| InChIKey | HMVFHMLPFAZHEW-VQHVLOKHSA-N |
| SMILES | C/C(=C(/C(=O)NC1=CC=CC=C1)\N=O)/O |
Computed by PubChem (NCBI)