Products 1956331-83-1
CAS 1956331-83-1 appears in our catalog under these names: 3-(4-(Trifluoromethoxy)phenyl)azetidine hydrochloride, 97%, 97%, 3-(4-(TRIFLUOROMETHOXY)PHENYL)AZETIDINE HCL, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[4-(trifluoromethoxy)phenyl]azetidine;hydrochloride (CAS 1956331-83-1) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 3-[4-(trifluoromethoxy)phenyl]azetidine;hydrochloride. InChIKey: MPIIIDIAWDXKSN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 3-[4-(trifluoromethoxy)phenyl]azetidine;hydrochloride |
| InChIKey | MPIIIDIAWDXKSN-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)