CAS 1956381-59-1 is the registry number for 2-(3,3-Dimethyl-2-oxo-2,3-dihydro-1h-benzo[b][1,4]oxazin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid (CAS 1956381-59-1) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid. InChIKey: QDCBNVMPJFLKIE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid |
| InChIKey | QDCBNVMPJFLKIE-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)OC2=C(N1)C=C(C=C2)CC(=O)O)C |
Computed by PubChem (NCBI)