Products 1956381-59-1

CAS 1956381-59-1 is the registry number for 2-(3,3-Dimethyl-2-oxo-2,3-dihydro-1h-benzo[b][1,4]oxazin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.

Structural formula: {0} (CAS {1})

2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid (CAS 1956381-59-1) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid. InChIKey: QDCBNVMPJFLKIE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO4
Molecular weight235.24 g/mol
IUPAC name2-(3,3-dimethyl-2-oxo-4H-1,4-benzoxazin-6-yl)acetic acid
InChIKeyQDCBNVMPJFLKIE-UHFFFAOYSA-N
SMILESCC1(C(=O)OC2=C(N1)C=C(C=C2)CC(=O)O)C

Computed by PubChem (NCBI)