Products 83734-42-3
CAS 83734-42-3 appears in our catalog under these names: (E)–3–(3–ethoxyacrylaMido)benzoic acid, (E)-3-(3-Ethoxyacrylamido)benzoic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
3-[[(E)-3-ethoxyprop-2-enoyl]amino]benzoic acid (CAS 83734-42-3) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 3-[[(E)-3-ethoxyprop-2-enoyl]amino]benzoic acid. InChIKey: YZMGOVZHTUYCIT-VOTSOKGWSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 3-[[(E)-3-ethoxyprop-2-enoyl]amino]benzoic acid |
| InChIKey | YZMGOVZHTUYCIT-VOTSOKGWSA-N |
| SMILES | CCO/C=C/C(=O)NC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)