Products 858756-82-8
CAS 858756-82-8 appears in our catalog under these names: 4,5-Dimethoxy-1-methyl-1h-indole-2-carboxylic acid, 95%, 4,5-Dimethoxy-1-methyl-1H-indole-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4,5-dimethoxy-1-methylindole-2-carboxylic acid (CAS 858756-82-8) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 4,5-dimethoxy-1-methylindole-2-carboxylic acid. InChIKey: FDVUHHSIORKKMP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4,5-dimethoxy-1-methylindole-2-carboxylic acid |
| InChIKey | FDVUHHSIORKKMP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C(=O)O)C(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)