CAS 61081-80-9 is the registry number for Cyclopentyl 4-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Cyclopentyl 4-nitrobenzoate (CAS 61081-80-9) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: cyclopentyl 4-nitrobenzoate. InChIKey: WPKVBNFXUGNXGX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | cyclopentyl 4-nitrobenzoate |
| InChIKey | WPKVBNFXUGNXGX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)