CAS 876717-57-6 is the registry number for 2-(2-Methyl-3-oxo-2,3-dihydro-4h-1,4-benzoxazin-4-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoic acid (CAS 876717-57-6) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoic acid. InChIKey: TYKNSYRLVRTNBF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoic acid |
| InChIKey | TYKNSYRLVRTNBF-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C2=CC=CC=C2O1)C(C)C(=O)O |
Computed by PubChem (NCBI)