Products 1956426-85-9
CAS 1956426-85-9 appears in our catalog under these names: 3-(5-Bromo-2-methoxy-pyridin-3-yl)-acrylic acid methyl ester, 95%, Methyl 3-(5-bromo-2-methoxypyridin-3-yl)acrylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl (E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoate (CAS 1956426-85-9) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: methyl (E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoate. InChIKey: GNKHKQXOIJBPHU-ONEGZZNKSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | methyl (E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoate |
| InChIKey | GNKHKQXOIJBPHU-ONEGZZNKSA-N |
| SMILES | COC1=C(C=C(C=N1)Br)/C=C/C(=O)OC |
Computed by PubChem (NCBI)