Products 1956437-75-4
CAS 1956437-75-4 is the registry number for (S)-tert-Butyl 4-(1-aminoethyl)piperidine-1-carboxylate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-[(1S)-1-aminoethyl]piperidine-1-carboxylate;hydrochloride (CAS 1956437-75-4) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl 4-[(1S)-1-aminoethyl]piperidine-1-carboxylate;hydrochloride. InChIKey: VDXOVROHRYTYHL-FVGYRXGTSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl 4-[(1S)-1-aminoethyl]piperidine-1-carboxylate;hydrochloride |
| InChIKey | VDXOVROHRYTYHL-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1CCN(CC1)C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)