CAS 1958063-16-5 is the registry number for 1-(2-Amino-1-(4-fluorophenyl)ethyl)pyrrolidine-3-carboxylic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
1-[2-amino-1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1958063-16-5) is a chemical compound with the molecular formula C13H18ClFN2O2 and a molecular weight of 288.74 g/mol. IUPAC name: 1-[2-amino-1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: VTRGPIFROHKUKF-UHFFFAOYSA-N.
| Molecular formula | C13H18ClFN2O2 |
|---|---|
| Molecular weight | 288.74 g/mol |
| IUPAC name | 1-[2-amino-1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | VTRGPIFROHKUKF-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)C(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)