Products 195823-07-5

CAS 195823-07-5 is the registry number for 2,6-Dichlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,6-dichlorobenzoyl fluoride (CAS 195823-07-5) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,6-dichlorobenzoyl fluoride. InChIKey: IBNUJVBCSKFVIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO
Molecular weight193.00 g/mol
IUPAC name2,6-dichlorobenzoyl fluoride
InChIKeyIBNUJVBCSKFVIZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)C(=O)F)Cl

Computed by PubChem (NCBI)