CAS 195983-60-9 appears in our catalog under these names: 8-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 97%, 8–Chloro–3,4–dihydro–1H–benzo(e)(1,4)diazepine–2,5–dione, 8-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%, 98%, 8-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 100mg, 25mg, 500mg.
8-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 195983-60-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 8-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: FAVPJIZQGHYIEW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 8-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | FAVPJIZQGHYIEW-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC(=C2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)