Products 2682097-03-4
CAS 2682097-03-4 appears in our catalog under these names: (3R,6R)-6-Methylpiperidine-3-carboxylic acid hydrochloride, 95%, 95%, (3R,6R)-6-Methylpiperidine-3-carboxylic acid hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(3R,6R)-6-methylpiperidine-3-carboxylic acid;hydrochloride (CAS 2682097-03-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (3R,6R)-6-methylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: NJNNMKIITLUFIE-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (3R,6R)-6-methylpiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | NJNNMKIITLUFIE-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1)C(=O)O.Cl |
Computed by PubChem (NCBI)