CAS 1965314-65-1 is the registry number for (S)-6-(2-(Methylamino)propyl)-1,3-benzodioxol-4-ol Hydrochloride. Offered by: TRC. Available pack sizes: 75mg.
6-[(2S)-2-(methylamino)propyl]-1,3-benzodioxol-4-ol;hydrochloride (CAS 1965314-65-1) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 6-[(2S)-2-(methylamino)propyl]-1,3-benzodioxol-4-ol;hydrochloride. InChIKey: VMMMAYRXDIZLDL-FJXQXJEOSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 6-[(2S)-2-(methylamino)propyl]-1,3-benzodioxol-4-ol;hydrochloride |
| InChIKey | VMMMAYRXDIZLDL-FJXQXJEOSA-N |
| SMILES | C[C@@H](CC1=CC(=C2C(=C1)OCO2)O)NC.Cl |
Computed by PubChem (NCBI)