CAS 1967003-62-8 is the registry number for tert-Butyl (s)-6-methyl-6,7-dihydropyrazolo(1,5-a)pyrazine-5(4h)-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (6S)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 1967003-62-8) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl (6S)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: DMKHMDWQRSPOAU-VIFPVBQESA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl (6S)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | DMKHMDWQRSPOAU-VIFPVBQESA-N |
| SMILES | C[C@H]1CN2C(=CC=N2)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)