CAS 196803-72-2 appears in our catalog under these names: 4–Chloro–6,8–dimethylquinoline, 4-Chloro-6,8-dimethylquinoline 95%, 4-Chloro-6,8-dimethylquinoline, 95%, 95%, 4-chloro-6,8-dimethylquinoline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
4-chloro-6,8-dimethylquinoline (CAS 196803-72-2) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-6,8-dimethylquinoline. InChIKey: OREYGYAAYFXMIZ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-6,8-dimethylquinoline |
| InChIKey | OREYGYAAYFXMIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN=C2C(=C1)C)Cl |
Computed by PubChem (NCBI)