CAS 19687-73-1 appears in our catalog under these names: 2–NP–AOZ, 2-NP-AOZ, >95% (HPLC), 2-NP-AOZ, 97%, 2-NP-AOZ, 2-NP-AOZ, Vetranal. Offered by: GLPBio, TRC, AmBeed, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 1mg, 100mg, 250mg, 25mg, 1g, 10mg, 5mg, 50mg.
3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one (CAS 19687-73-1) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one. InChIKey: OHYXOGZWSSNLON-YRNVUSSQSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one |
| InChIKey | OHYXOGZWSSNLON-YRNVUSSQSA-N |
| SMILES | C1COC(=O)N1/N=C/C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)