CAS 19703-86-7 is the registry number for LU 2443. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-5-phenyl-1,3,4-thiadiazol-4-ium-2-thiolate (CAS 19703-86-7) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 4-methyl-5-phenyl-1,3,4-thiadiazol-4-ium-2-thiolate. InChIKey: KKABNDWCHGAGAZ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 4-methyl-5-phenyl-1,3,4-thiadiazol-4-ium-2-thiolate |
| InChIKey | KKABNDWCHGAGAZ-UHFFFAOYSA-N |
| SMILES | C[N+]1=C(SC(=N1)[S-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)