Products 25625-62-1

CAS 25625-62-1 is the registry number for 6-Methylquinoxaline-2,3-dithiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

6-methyl-1,4-dihydroquinoxaline-2,3-dithione (CAS 25625-62-1) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 6-methyl-1,4-dihydroquinoxaline-2,3-dithione. InChIKey: YTKGLURLTLIZJG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2S2
Molecular weight208.3 g/mol
IUPAC name6-methyl-1,4-dihydroquinoxaline-2,3-dithione
InChIKeyYTKGLURLTLIZJG-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)NC(=S)C(=S)N2

Computed by PubChem (NCBI)