CAS 25625-62-1 is the registry number for 6-Methylquinoxaline-2,3-dithiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 100g, 1g.
6-methyl-1,4-dihydroquinoxaline-2,3-dithione (CAS 25625-62-1) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 6-methyl-1,4-dihydroquinoxaline-2,3-dithione. InChIKey: YTKGLURLTLIZJG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 6-methyl-1,4-dihydroquinoxaline-2,3-dithione |
| InChIKey | YTKGLURLTLIZJG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=S)C(=S)N2 |
Computed by PubChem (NCBI)