CAS 85103-31-7 appears in our catalog under these names: 5–(p–Tolyl)–1,3,4–thiadiazole–2(3H)–thione, 5-(p-Tolyl)-1,3,4-thiadiazole-2(3H)-thione, 97%, 97%, 5-benzyl-2,3-dihydro-1,3,4-thiadiazole-2-thione, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-(4-methylphenyl)-3H-1,3,4-thiadiazole-2-thione (CAS 85103-31-7) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 5-(4-methylphenyl)-3H-1,3,4-thiadiazole-2-thione. InChIKey: URJNYJWVJQFSHY-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 5-(4-methylphenyl)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | URJNYJWVJQFSHY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)S2 |
Computed by PubChem (NCBI)