CAS 306281-11-8 is the registry number for 2,3-Dihydro-1h-8-thia-5,7-diaza-cyclopenta[a]indene-4-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-12-thione (CAS 306281-11-8) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-12-thione. InChIKey: UZIFVIYMKOHMQD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-12-thione |
| InChIKey | UZIFVIYMKOHMQD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC3=C2C(=S)NC=N3 |
Computed by PubChem (NCBI)