Products 1972616-04-8
CAS 1972616-04-8 is the registry number for CO delivery molecule 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(diethylamino)phenyl]-3-hydroxybenzo[g]chromen-4-one (CAS 1972616-04-8) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: 2-[4-(diethylamino)phenyl]-3-hydroxybenzo[g]chromen-4-one. InChIKey: OBYZZGFUBNNRKM-UHFFFAOYSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-[4-(diethylamino)phenyl]-3-hydroxybenzo[g]chromen-4-one |
| InChIKey | OBYZZGFUBNNRKM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=C(C(=O)C3=CC4=CC=CC=C4C=C3O2)O |
Computed by PubChem (NCBI)