Products 1975-43-5
CAS 1975-43-5 appears in our catalog under these names: 4-Nitro-1-naphthoic acid, 95%, 4–Nitro–1–naphthoic acid, 4-Nitro-1-naphthoic acid 97%, 4-Nitro-1-naphthoic acid, 97%, 97%, 4-Nitro-1-naphthoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-nitronaphthalene-1-carboxylic acid (CAS 1975-43-5) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 4-nitronaphthalene-1-carboxylic acid. InChIKey: BQBFFSOHVNNCSP-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 4-nitronaphthalene-1-carboxylic acid |
| InChIKey | BQBFFSOHVNNCSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)