CAS 51066-70-7 appears in our catalog under these names: 3-(1,3-Dioxaindan-5-yl)-2-cyanoprop-2-enoic acid, 95%, 3-(1,3-Dioxaindan-5-yl)-2-cyanoprop-2-enoic acid, 3-(Benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylic acid, 95%, 95%, (Z)-3-(benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylic acid, 98%, 3-(Benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g, 100mg.
(Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid (CAS 51066-70-7) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid. InChIKey: LJKHUTHWDPAAIA-BAQGIRSFSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoic acid |
| InChIKey | LJKHUTHWDPAAIA-BAQGIRSFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C(/C#N)\C(=O)O |
Computed by PubChem (NCBI)