CAS 13148-43-1 appears in our catalog under these names: 5-(3-Nitrophenyl)-2-furaldehyde, 95%, 5-(3-Nitrophenyl)-2-furaldehyde. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-(3-nitrophenyl)furan-2-carbaldehyde (CAS 13148-43-1) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 5-(3-nitrophenyl)furan-2-carbaldehyde. InChIKey: DXUACWQWQDJZMY-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 5-(3-nitrophenyl)furan-2-carbaldehyde |
| InChIKey | DXUACWQWQDJZMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)