CAS 1126633-88-2 is the registry number for 2-(Benzo[d][1,3]dioxol-5-yl)oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzodioxol-5-yl)-1,3-oxazole-5-carbaldehyde (CAS 1126633-88-2) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-5-carbaldehyde. InChIKey: PDFOUDZNSSEEPG-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-1,3-oxazole-5-carbaldehyde |
| InChIKey | PDFOUDZNSSEEPG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC=C(O3)C=O |
Computed by PubChem (NCBI)