CAS 103987-83-3 appears in our catalog under these names: 1-Nitro-2-naphthoic acid, 95%, 1–Nitro–2–naphthoic acid, 1-Nitro-2-naphtoic acid, 1-Nitro-2-naphthoic acid, 95%, 95%, 1-Nitro-2-naphthoic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
1-nitronaphthalene-2-carboxylic acid (CAS 103987-83-3) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 1-nitronaphthalene-2-carboxylic acid. InChIKey: RMWJWWYYJRAOMD-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 1-nitronaphthalene-2-carboxylic acid |
| InChIKey | RMWJWWYYJRAOMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)