CAS 197501-89-6 is the registry number for N-(4-Chlorophenethyl)-phthalimide. Offered by: TRC. Available pack sizes: 1g.
2-[2-(4-chlorophenyl)ethyl]isoindole-1,3-dione (CAS 197501-89-6) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)ethyl]isoindole-1,3-dione. InChIKey: WBXUSDQHJRQUMR-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)ethyl]isoindole-1,3-dione |
| InChIKey | WBXUSDQHJRQUMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)