Products 1977-33-9

CAS 1977-33-9 is the registry number for 4-(2,4-Dihydroxy-3,3-dimethylbutanamido)butanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]butanoic acid (CAS 1977-33-9) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: 4-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]butanoic acid. InChIKey: SBBDHANTMHIRGW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO5
Molecular weight233.26 g/mol
IUPAC name4-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]butanoic acid
InChIKeySBBDHANTMHIRGW-UHFFFAOYSA-N
SMILESCC(C)(CO)C(C(=O)NCCCC(=O)O)O

Computed by PubChem (NCBI)