CAS 19772-76-0 appears in our catalog under these names: DL-Willardiine/ 99.83% (existing batch purity), 2-amino-3-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoic acid, DL-Willardiine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg.
2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 19772-76-0) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: FACUYWPMDKTVFU-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoic acid |
| InChIKey | FACUYWPMDKTVFU-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)NC1=O)CC(C(=O)O)N |
Computed by PubChem (NCBI)